C15H23N5O3 — CID 175959823
(2S)-5-(diaminomethylideneamino)-2-[(2-nitroso-1-phenylpropan-2-yl)amino]pentanoic acid (PubChem CID 175959823) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[(2-nitroso-1-phenylpropan-2-yl)amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[(2-nitroso-1-phenylpropan-2-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 175959823 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[(2-nitroso-1-phenylpropan-2-yl)amino]pentanoic acid |
| SMILES | CC(Cc1ccccc1)(N=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C15H23N5O3/c1-15(20-23,10-11-6-3-2-4-7-11)19-12(13(21)22)8-5-9-18-14(16)17/h2-4,6-7,12,19H,5,8-10H2,1H3,(H,21,22)(H4,16,17,18)/t12-,15?/m0/s1 |
| InChIKey | VUNSGXOIJGLDJW-SFVWDYPZSA-N |
| XLogP | 0.81 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|