C16H15N3O2 — CID 175978589
methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate (PubChem CID 175978589) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate |
|---|---|
| PubChem CID | 175978589 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2C=C(n3cccn3)CC=N2)cc1 |
| InChI | InChI=1S/C16H15N3O2/c1-21-16(20)13-5-3-12(4-6-13)15-11-14(7-9-17-15)19-10-2-8-18-19/h2-6,8-11,15H,7H2,1H3/t15-/m0/s1 |
| InChIKey | NBVVCVMWVKGMPC-HNNXBMFYSA-N |
| XLogP | 2.73 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |