methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate

C16H15N3O2 — CID 175978589

IUPACmethyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate
SMILESCOC(=O)c1ccc([C@@H]2C=C(n3cccn3)CC=N2)cc1
InChIInChI=1S/C16H15N3O2/c1-21-16(20)13-5-3-12(4-6-13)15-11-14(7-9-17-15)19-10-2-8-18-19/h2-6,8-11,15H,7H2,1H3/t15-/m0/s1
InChIKeyNBVVCVMWVKGMPC-HNNXBMFYSA-N
MW281.32 g/mol
LogP2.73
Rot. Bonds3

About methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate

methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate (PubChem CID 175978589) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate.

Molecular Properties

Compound Namemethyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate
PubChem CID175978589
Molecular FormulaC16H15N3O2
Molecular Weight281.32 g/mol
Exact Mass281.12
IUPAC Namemethyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate
SMILESCOC(=O)c1ccc([C@@H]2C=C(n3cccn3)CC=N2)cc1
InChIInChI=1S/C16H15N3O2/c1-21-16(20)13-5-3-12(4-6-13)15-11-14(7-9-17-15)19-10-2-8-18-19/h2-6,8-11,15H,7H2,1H3/t15-/m0/s1
InChIKeyNBVVCVMWVKGMPC-HNNXBMFYSA-N
XLogP2.73
TPSA56.48 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.32
LogP ≤ 52.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate?
The IUPAC name of methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate (CID 175978589) is methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate.
What is the SMILES notation for methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate?
The canonical SMILES for methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate is COC(=O)c1ccc([C@@H]2C=C(n3cccn3)CC=N2)cc1.
What is the InChIKey of methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate?
The InChIKey is NBVVCVMWVKGMPC-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H15N3O2/c1-21-16(20)13-5-3-12(4-6-13)15-11-14(7-9-17-15)19-10-2-8-18-19/h2-6,8-11,15H,7H2,1H3/t15-/m0/s1.
What are the key properties of methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate?
methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate has a molecular weight of 281.32 g/mol, XLogP of 2.73, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2S)-4-pyrazol-1-yl-2,5-dihydropyridin-2-yl]benzoate is sourced from PubChem (CID 175978589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).