C19H46O4Si4 — CID 175981692
5-methylidene-9-tris(trimethylsilyloxy)silylnonan-1-ol (PubChem CID 175981692) has the molecular formula C19H46O4Si4 and a molecular weight of 450.92 g/mol. Its IUPAC name is 5-methylidene-9-tris(trimethylsilyloxy)silylnonan-1-ol.
| Compound Name | 5-methylidene-9-tris(trimethylsilyloxy)silylnonan-1-ol |
|---|---|
| PubChem CID | 175981692 |
| Molecular Formula | C19H46O4Si4 |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 5-methylidene-9-tris(trimethylsilyloxy)silylnonan-1-ol |
| SMILES | C=C(CCCCO)CCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H46O4Si4/c1-19(15-11-13-17-20)16-12-14-18-27(21-24(2,3)4,22-25(5,6)7)23-26(8,9)10/h20H,1,11-18H2,2-10H3 |
| InChIKey | KVPAIGPRISRLQH-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|