C7H11NO4 — CID 175984753
3,3a,4,6,7,7a-hexahydro-2H-pyrano[3,4-d][1,3]oxazole-6-carboxylic acid (PubChem CID 175984753) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is 3,3a,4,6,7,7a-hexahydro-2H-pyrano[3,4-d][1,3]oxazole-6-carboxylic acid.
| Compound Name | 3,3a,4,6,7,7a-hexahydro-2H-pyrano[3,4-d][1,3]oxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 175984753 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 3,3a,4,6,7,7a-hexahydro-2H-pyrano[3,4-d][1,3]oxazole-6-carboxylic acid |
| SMILES | O=C(O)C1CC2OCNC2CO1 |
| InChI | InChI=1S/C7H11NO4/c9-7(10)6-1-5-4(2-11-6)8-3-12-5/h4-6,8H,1-3H2,(H,9,10) |
| InChIKey | HUDDPAXRUPFLEC-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |