C7H16N2O2S — CID 175985228
(2S)-4-methyl-2-(2-methylsulfanylhydrazinyl)pentanoic acid (PubChem CID 175985228) has the molecular formula C7H16N2O2S and a molecular weight of 192.28 g/mol. Its IUPAC name is (2S)-4-methyl-2-(2-methylsulfanylhydrazinyl)pentanoic acid.
| Compound Name | (2S)-4-methyl-2-(2-methylsulfanylhydrazinyl)pentanoic acid |
|---|---|
| PubChem CID | 175985228 |
| Molecular Formula | C7H16N2O2S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (2S)-4-methyl-2-(2-methylsulfanylhydrazinyl)pentanoic acid |
| SMILES | CSNN[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C7H16N2O2S/c1-5(2)4-6(7(10)11)8-9-12-3/h5-6,8-9H,4H2,1-3H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | RWFQDCRFZADCQT-LURJTMIESA-N |
| XLogP | 0.86 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|