C15H14ClF3N2OS — CID 175987921
4-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]benzamide;hydrochloride (PubChem CID 175987921) has the molecular formula C15H14ClF3N2OS and a molecular weight of 362.80 g/mol. Its IUPAC name is 4-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]benzamide;hydrochloride.
| Compound Name | 4-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 175987921 |
| Molecular Formula | C15H14ClF3N2OS |
| Molecular Weight | 362.80 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 4-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]benzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1ccc(NCc2ccc(SC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C15H13F3N2OS.ClH/c16-15(17,18)22-13-7-1-10(2-8-13)9-20-12-5-3-11(4-6-12)14(19)21;/h1-8,20H,9H2,(H2,19,21);1H |
| InChIKey | MKUARIQNKKCONW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.80 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |