C19H14N4O2 — CID 175988865
4-(4-phenoxyanilino)-7H-pyrrolo[2,3-d]pyrimidine-2-carbaldehyde (PubChem CID 175988865) has the molecular formula C19H14N4O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 4-(4-phenoxyanilino)-7H-pyrrolo[2,3-d]pyrimidine-2-carbaldehyde.
| Compound Name | 4-(4-phenoxyanilino)-7H-pyrrolo[2,3-d]pyrimidine-2-carbaldehyde |
|---|---|
| PubChem CID | 175988865 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 4-(4-phenoxyanilino)-7H-pyrrolo[2,3-d]pyrimidine-2-carbaldehyde |
| SMILES | O=Cc1nc(Nc2ccc(Oc3ccccc3)cc2)c2cc[nH]c2n1 |
| InChI | InChI=1S/C19H14N4O2/c24-12-17-22-18-16(10-11-20-18)19(23-17)21-13-6-8-15(9-7-13)25-14-4-2-1-3-5-14/h1-12H,(H2,20,21,22,23) |
| InChIKey | FHLNGBZKIQMDPA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|