C16H18F6INO2 — CID 176508075
1-[[3-iodo-5-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(trifluoromethyl)piperidine (PubChem CID 176508075) has the molecular formula C16H18F6INO2 and a molecular weight of 497.22 g/mol. Its IUPAC name is 1-[[3-iodo-5-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(trifluoromethyl)piperidine.
| Compound Name | 1-[[3-iodo-5-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 176508075 |
| Molecular Formula | C16H18F6INO2 |
| Molecular Weight | 497.22 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | 1-[[3-iodo-5-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(trifluoromethyl)piperidine |
| SMILES | COc1cc(CN2CCCC(C(F)(F)F)C2)cc(I)c1OCC(F)(F)F |
| InChI | InChI=1S/C16H18F6INO2/c1-25-13-6-10(5-12(23)14(13)26-9-15(17,18)19)7-24-4-2-3-11(8-24)16(20,21)22/h5-6,11H,2-4,7-9H2,1H3 |
| InChIKey | YPTBZHIRJFQTJR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.22 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|