C14H10N2O3 — CID 176508893
1-(5-ethynyl-1-benzofuran-3-yl)-1,3-diazinane-2,4-dione (PubChem CID 176508893) has the molecular formula C14H10N2O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-(5-ethynyl-1-benzofuran-3-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(5-ethynyl-1-benzofuran-3-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 176508893 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-(5-ethynyl-1-benzofuran-3-yl)-1,3-diazinane-2,4-dione |
| SMILES | C#Cc1ccc2occ(N3CCC(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C14H10N2O3/c1-2-9-3-4-12-10(7-9)11(8-19-12)16-6-5-13(17)15-14(16)18/h1,3-4,7-8H,5-6H2,(H,15,17,18) |
| InChIKey | JXXVKHODWHJYJK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|