C21H25N4O6PS — CID 176509168
4-[[diethoxyphosphoryl-(3-hydroxyphenyl)methyl]amino]-N-pyrimidin-2-ylbenzenesulfonamide (PubChem CID 176509168) has the molecular formula C21H25N4O6PS and a molecular weight of 492.49 g/mol. Its IUPAC name is 4-[[diethoxyphosphoryl-(3-hydroxyphenyl)methyl]amino]-N-pyrimidin-2-ylbenzenesulfonamide.
| Compound Name | 4-[[diethoxyphosphoryl-(3-hydroxyphenyl)methyl]amino]-N-pyrimidin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 176509168 |
| Molecular Formula | C21H25N4O6PS |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 4-[[diethoxyphosphoryl-(3-hydroxyphenyl)methyl]amino]-N-pyrimidin-2-ylbenzenesulfonamide |
| SMILES | CCOP(=O)(OCC)C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1cccc(O)c1 |
| InChI | InChI=1S/C21H25N4O6PS/c1-3-30-32(27,31-4-2)20(16-7-5-8-18(26)15-16)24-17-9-11-19(12-10-17)33(28,29)25-21-22-13-6-14-23-21/h5-15,20,24,26H,3-4H2,1-2H3,(H,22,23,25) |
| InChIKey | ZEWKZSZXMCODTI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|