About 2,10-diaminodec-1-en-1-one;pentahydrate
2,10-diaminodec-1-en-1-one;pentahydrate (PubChem CID 176520266) has the molecular formula C10H30N2O6
and a molecular weight of 274.36 g/mol. Its IUPAC name is 2,10-diaminodec-1-en-1-one;pentahydrate.
Molecular Properties
| Compound Name | 2,10-diaminodec-1-en-1-one;pentahydrate |
| PubChem CID | 176520266 |
| Molecular Formula | C10H30N2O6 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 2,10-diaminodec-1-en-1-one;pentahydrate |
| SMILES | NCCCCCCCCC(N)=C=O.O.O.O.O.O |
| InChI | InChI=1S/C10H20N2O.5H2O/c11-8-6-4-2-1-3-5-7-10(12)9-13;;;;;/h1-8,11-12H2;5*1H2 |
| InChIKey | IOOPIIIKRVNYRZ-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 226.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 2,10-diaminodec-1-en-1-one;pentahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,10-diaminodec-1-en-1-one;pentahydrate?
The IUPAC name of 2,10-diaminodec-1-en-1-one;pentahydrate (CID 176520266) is 2,10-diaminodec-1-en-1-one;pentahydrate.
What is the SMILES notation for 2,10-diaminodec-1-en-1-one;pentahydrate?
The canonical SMILES for 2,10-diaminodec-1-en-1-one;pentahydrate is NCCCCCCCCC(N)=C=O.O.O.O.O.O.
What is the InChIKey of 2,10-diaminodec-1-en-1-one;pentahydrate?
The InChIKey is IOOPIIIKRVNYRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O.5H2O/c11-8-6-4-2-1-3-5-7-10(12)9-13;;;;;/h1-8,11-12H2;5*1H2.
What are the key properties of 2,10-diaminodec-1-en-1-one;pentahydrate?
2,10-diaminodec-1-en-1-one;pentahydrate has a molecular weight of 274.36 g/mol, XLogP of -2.77, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,10-diaminodec-1-en-1-one;pentahydrate is sourced from PubChem (CID 176520266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).