C19H35N5 — CID 176524411
N-[N-[(E)-but-2-enyl]-N-but-3-enylcarbamimidoyl]-N'-[[but-3-enyl(butyl)amino]methyl]methanimidamide (PubChem CID 176524411) has the molecular formula C19H35N5 and a molecular weight of 333.52 g/mol. Its IUPAC name is N-[N-[(E)-but-2-enyl]-N-but-3-enylcarbamimidoyl]-N'-[[but-3-enyl(butyl)amino]methyl]methanimidamide.
| Compound Name | N-[N-[(E)-but-2-enyl]-N-but-3-enylcarbamimidoyl]-N'-[[but-3-enyl(butyl)amino]methyl]methanimidamide |
|---|---|
| PubChem CID | 176524411 |
| Molecular Formula | C19H35N5 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.29 |
| IUPAC Name | N-[N-[(E)-but-2-enyl]-N-but-3-enylcarbamimidoyl]-N'-[[but-3-enyl(butyl)amino]methyl]methanimidamide |
| SMILES | [H]/N=C(\NC=NCN(CCC=C)CCCC)N(C/C=C/C)CCC=C |
| InChI | InChI=1S/C19H35N5/c1-5-9-13-23(14-10-6-2)18-21-17-22-19(20)24(15-11-7-3)16-12-8-4/h5,7-8,12,17H,1,3,6,9-11,13-16,18H2,2,4H3,(H2,20,21,22)/b12-8+ |
| InChIKey | HKGPAYXKGOEIIF-XYOKQWHBSA-N |
| XLogP | 3.63 |
| TPSA | 54.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|