C18H15IN2O3S2 — CID 176526167
N-[[5-(phenylsulfamoyl)thiophen-2-yl]methyl]-1λ3-iodacyclohepta-1,2,4,6-tetraene-4-carboxamide (PubChem CID 176526167) has the molecular formula C18H15IN2O3S2 and a molecular weight of 498.37 g/mol. Its IUPAC name is N-[[5-(phenylsulfamoyl)thiophen-2-yl]methyl]-1λ3-iodacyclohepta-1,2,4,6-tetraene-4-carboxamide.
| Compound Name | N-[[5-(phenylsulfamoyl)thiophen-2-yl]methyl]-1λ3-iodacyclohepta-1,2,4,6-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 176526167 |
| Molecular Formula | C18H15IN2O3S2 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 497.96 |
| IUPAC Name | N-[[5-(phenylsulfamoyl)thiophen-2-yl]methyl]-1λ3-iodacyclohepta-1,2,4,6-tetraene-4-carboxamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)Nc2ccccc2)s1)C1=CC=CI=C=C1 |
| InChI | InChI=1S/C18H15IN2O3S2/c22-18(14-5-4-11-19-12-10-14)20-13-16-8-9-17(25-16)26(23,24)21-15-6-2-1-3-7-15/h1-11,21H,13H2,(H,20,22) |
| InChIKey | PYBJUCHKFZFRTC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|