C6H5NO5 — CID 176532489
buta-2,3-dienoyl(carboxy)carbamic acid (PubChem CID 176532489) has the molecular formula C6H5NO5 and a molecular weight of 171.11 g/mol. Its IUPAC name is buta-2,3-dienoyl(carboxy)carbamic acid.
| Compound Name | buta-2,3-dienoyl(carboxy)carbamic acid |
|---|---|
| PubChem CID | 176532489 |
| Molecular Formula | C6H5NO5 |
| Molecular Weight | 171.11 g/mol |
| Exact Mass | 171.02 |
| IUPAC Name | buta-2,3-dienoyl(carboxy)carbamic acid |
| SMILES | C=C=CC(=O)N(C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H5NO5/c1-2-3-4(8)7(5(9)10)6(11)12/h3H,1H2,(H,9,10)(H,11,12) |
| InChIKey | GEUXHONXAGELFI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.11 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|