C34H68N6S2 — CID 176535556
(4S)-1-[4-[(4S)-3-(4-cyclohexylbutyl)-2-iminoimidazolidin-4-yl]butyl]-4-(cyclohexylmethyl)-3-heptylimidazolidin-2-imine;sulfane (PubChem CID 176535556) has the molecular formula C34H68N6S2 and a molecular weight of 625.09 g/mol. Its IUPAC name is (4S)-1-[4-[(4S)-3-(4-cyclohexylbutyl)-2-iminoimidazolidin-4-yl]butyl]-4-(cyclohexylmethyl)-3-heptylimidazolidin-2-imine;sulfane.
| Compound Name | (4S)-1-[4-[(4S)-3-(4-cyclohexylbutyl)-2-iminoimidazolidin-4-yl]butyl]-4-(cyclohexylmethyl)-3-heptylimidazolidin-2-imine;sulfane |
|---|---|
| PubChem CID | 176535556 |
| Molecular Formula | C34H68N6S2 |
| Molecular Weight | 625.09 g/mol |
| Exact Mass | 624.49 |
| IUPAC Name | (4S)-1-[4-[(4S)-3-(4-cyclohexylbutyl)-2-iminoimidazolidin-4-yl]butyl]-4-(cyclohexylmethyl)-3-heptylimidazolidin-2-imine;sulfane |
| SMILES | S.S.[H]/N=C1\NC[C@H](CCCCN2C[C@H](CC3CCCCC3)N(CCCCCCC)/C2=N/[H])N1CCCCC1CCCCC1 |
| InChI | InChI=1S/C34H64N6.2H2S/c1-2-3-4-5-14-25-40-32(26-30-20-10-7-11-21-30)28-38(34(40)36)23-15-13-22-31-27-37-33(35)39(31)24-16-12-19-29-17-8-6-9-18-29;;/h29-32,36H,2-28H2,1H3,(H2,35,37);2*1H2/b36-34+;;/t31-,32-;;/m0../s1 |
| InChIKey | IPRILUNZTAKIRE-VJQNWCFHSA-N |
| XLogP | 8.20 |
| TPSA | 69.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.09 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|