C37H70N6 — CID 176518921
(4S)-4-butyl-1-[4-[(4S)-3-[4-(3-ethyl-7-methyl-1-bicyclo[3.3.1]nonanyl)butyl]-2-iminoimidazolidin-4-yl]butyl]-3-heptylimidazolidin-2-imine (PubChem CID 176518921) has the molecular formula C37H70N6 and a molecular weight of 599.01 g/mol. Its IUPAC name is (4S)-4-butyl-1-[4-[(4S)-3-[4-(3-ethyl-7-methyl-1-bicyclo[3.3.1]nonanyl)butyl]-2-iminoimidazolidin-4-yl]butyl]-3-heptylimidazolidin-2-imine.
| Compound Name | (4S)-4-butyl-1-[4-[(4S)-3-[4-(3-ethyl-7-methyl-1-bicyclo[3.3.1]nonanyl)butyl]-2-iminoimidazolidin-4-yl]butyl]-3-heptylimidazolidin-2-imine |
|---|---|
| PubChem CID | 176518921 |
| Molecular Formula | C37H70N6 |
| Molecular Weight | 599.01 g/mol |
| Exact Mass | 598.57 |
| IUPAC Name | (4S)-4-butyl-1-[4-[(4S)-3-[4-(3-ethyl-7-methyl-1-bicyclo[3.3.1]nonanyl)butyl]-2-iminoimidazolidin-4-yl]butyl]-3-heptylimidazolidin-2-imine |
| SMILES | [H]/N=C1/N(CCCC[C@H]2CN/C(=N\[H])N2CCCCC23CC(C)CC(CC(CC)C2)C3)C[C@H](CCCC)N1CCCCCCC |
| InChI | InChI=1S/C37H70N6/c1-5-8-10-11-14-22-43-34(17-9-6-2)29-41(36(43)39)20-15-12-18-33-28-40-35(38)42(33)21-16-13-19-37-25-30(4)23-32(27-37)24-31(7-3)26-37/h30-34,39H,5-29H2,1-4H3,(H2,38,40)/b39-36-/t30?,31?,32?,33-,34-,37?/m0/s1 |
| InChIKey | HRPSKDGWZALGBK-GDXSIXGASA-N |
| XLogP | 8.86 |
| TPSA | 69.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.01 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|