C20H40N6 — CID 176518643
(4R)-1-[4-[(4S)-3-heptyl-2-iminoimidazolidin-4-yl]butyl]-4-propyl-4,5-dihydroimidazol-2-amine (PubChem CID 176518643) has the molecular formula C20H40N6 and a molecular weight of 364.58 g/mol. Its IUPAC name is (4R)-1-[4-[(4S)-3-heptyl-2-iminoimidazolidin-4-yl]butyl]-4-propyl-4,5-dihydroimidazol-2-amine.
| Compound Name | (4R)-1-[4-[(4S)-3-heptyl-2-iminoimidazolidin-4-yl]butyl]-4-propyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 176518643 |
| Molecular Formula | C20H40N6 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | (4R)-1-[4-[(4S)-3-heptyl-2-iminoimidazolidin-4-yl]butyl]-4-propyl-4,5-dihydroimidazol-2-amine |
| SMILES | [H]/N=C1\NC[C@H](CCCCN2C[C@@H](CCC)N=C2N)N1CCCCCCC |
| InChI | InChI=1S/C20H40N6/c1-3-5-6-7-9-14-26-18(15-23-19(26)21)12-8-10-13-25-16-17(11-4-2)24-20(25)22/h17-18H,3-16H2,1-2H3,(H2,21,23)(H2,22,24)/t17-,18+/m1/s1 |
| InChIKey | LCFRTZBAWQDNQL-MSOLQXFVSA-N |
| XLogP | 3.13 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|