C29H50N6 — CID 123613214
1-heptyl-5-[4-[2-imino-3-[2-(3-methylphenyl)ethyl]-4-propylimidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine (PubChem CID 123613214) has the molecular formula C29H50N6 and a molecular weight of 482.76 g/mol. Its IUPAC name is 1-heptyl-5-[4-[2-imino-3-[2-(3-methylphenyl)ethyl]-4-propylimidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-heptyl-5-[4-[2-imino-3-[2-(3-methylphenyl)ethyl]-4-propylimidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 123613214 |
| Molecular Formula | C29H50N6 |
| Molecular Weight | 482.76 g/mol |
| Exact Mass | 482.41 |
| IUPAC Name | 1-heptyl-5-[4-[2-imino-3-[2-(3-methylphenyl)ethyl]-4-propylimidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine |
| SMILES | [H]/N=C1\N(CCCCC2CN=C(N)N2CCCCCCC)CC(CCC)N1CCc1cccc(C)c1 |
| InChI | InChI=1S/C29H50N6/c1-4-6-7-8-10-19-34-26(22-32-28(34)30)16-9-11-18-33-23-27(13-5-2)35(29(33)31)20-17-25-15-12-14-24(3)21-25/h12,14-15,21,26-27,31H,4-11,13,16-20,22-23H2,1-3H3,(H2,30,32)/b31-29+ |
| InChIKey | WHBYSEYHHAXOEF-OWWNRXNESA-N |
| XLogP | 5.40 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.76 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|