C30H51N4+ — CID 102022036
3-butyl-4-methyl-1-[4-[3-[2-(3-methylphenyl)ethyl]-2-propyl-4,5-dihydroimidazol-4-yl]butyl]-2-propyl-4,5-dihydroimidazol-1-ium (PubChem CID 102022036) has the molecular formula C30H51N4+ and a molecular weight of 467.77 g/mol. Its IUPAC name is 3-butyl-4-methyl-1-[4-[3-[2-(3-methylphenyl)ethyl]-2-propyl-4,5-dihydroimidazol-4-yl]butyl]-2-propyl-4,5-dihydroimidazol-1-ium.
| Compound Name | 3-butyl-4-methyl-1-[4-[3-[2-(3-methylphenyl)ethyl]-2-propyl-4,5-dihydroimidazol-4-yl]butyl]-2-propyl-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 102022036 |
| Molecular Formula | C30H51N4+ |
| Molecular Weight | 467.77 g/mol |
| Exact Mass | 467.41 |
| IUPAC Name | 3-butyl-4-methyl-1-[4-[3-[2-(3-methylphenyl)ethyl]-2-propyl-4,5-dihydroimidazol-4-yl]butyl]-2-propyl-4,5-dihydroimidazol-1-ium |
| SMILES | CCCCN1C(CCC)=[N+](CCCCC2CN=C(CCC)N2CCc2cccc(C)c2)CC1C |
| InChI | InChI=1S/C30H51N4/c1-6-9-20-33-26(5)24-32(30(33)14-8-3)19-11-10-17-28-23-31-29(13-7-2)34(28)21-18-27-16-12-15-25(4)22-27/h12,15-16,22,26,28H,6-11,13-14,17-21,23-24H2,1-5H3/q+1 |
| InChIKey | XTEFISYRVOKVIO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 21.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.77 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|