C30H52N6 — CID 126669561
(5S)-5-[4-[4-butan-2-yl-2-imino-3-[2-(3-methylphenyl)ethyl]imidazolidin-1-yl]butyl]-1-heptyl-4,5-dihydroimidazol-2-amine (PubChem CID 126669561) has the molecular formula C30H52N6 and a molecular weight of 496.79 g/mol. Its IUPAC name is (5S)-5-[4-[4-butan-2-yl-2-imino-3-[2-(3-methylphenyl)ethyl]imidazolidin-1-yl]butyl]-1-heptyl-4,5-dihydroimidazol-2-amine.
| Compound Name | (5S)-5-[4-[4-butan-2-yl-2-imino-3-[2-(3-methylphenyl)ethyl]imidazolidin-1-yl]butyl]-1-heptyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 126669561 |
| Molecular Formula | C30H52N6 |
| Molecular Weight | 496.79 g/mol |
| Exact Mass | 496.43 |
| IUPAC Name | (5S)-5-[4-[4-butan-2-yl-2-imino-3-[2-(3-methylphenyl)ethyl]imidazolidin-1-yl]butyl]-1-heptyl-4,5-dihydroimidazol-2-amine |
| SMILES | [H]/N=C1\N(CCCC[C@H]2CN=C(N)N2CCCCCCC)CC(C(C)CC)N1CCc1cccc(C)c1 |
| InChI | InChI=1S/C30H52N6/c1-5-7-8-9-11-19-35-27(22-33-29(35)31)16-10-12-18-34-23-28(25(4)6-2)36(30(34)32)20-17-26-15-13-14-24(3)21-26/h13-15,21,25,27-28,32H,5-12,16-20,22-23H2,1-4H3,(H2,31,33)/b32-30+/t25?,27-,28?/m0/s1 |
| InChIKey | RSAVVHDGGIMMPX-BJLXILSRSA-N |
| XLogP | 5.64 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.79 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|