C12H18N2O — CID 176540372
(2Z)-2-(1-aminoethylidene)-N-propylhepta-3,4,6-trienamide (PubChem CID 176540372) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (2Z)-2-(1-aminoethylidene)-N-propylhepta-3,4,6-trienamide.
| Compound Name | (2Z)-2-(1-aminoethylidene)-N-propylhepta-3,4,6-trienamide |
|---|---|
| PubChem CID | 176540372 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (2Z)-2-(1-aminoethylidene)-N-propylhepta-3,4,6-trienamide |
| SMILES | C=CC=C=C/C(C(=O)NCCC)=C(\C)N |
| InChI | InChI=1S/C12H18N2O/c1-4-6-7-8-11(10(3)13)12(15)14-9-5-2/h4,6,8H,1,5,9,13H2,2-3H3,(H,14,15)/b11-10- |
| InChIKey | OSPKIVATVVDGTI-KHPPLWFESA-N |
| XLogP | 1.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|