C9H7F3N2OS — CID 176544068
N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]buta-2,3-dienamide (PubChem CID 176544068) has the molecular formula C9H7F3N2OS and a molecular weight of 248.23 g/mol. Its IUPAC name is N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]buta-2,3-dienamide.
| Compound Name | N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]buta-2,3-dienamide |
|---|---|
| PubChem CID | 176544068 |
| Molecular Formula | C9H7F3N2OS |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)NCc1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H7F3N2OS/c1-2-3-7(15)13-4-6-5-14-8(16-6)9(10,11)12/h3,5H,1,4H2,(H,13,15) |
| InChIKey | VTCGANVOKWQSQS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|