C32H50O5 — CID 176548972
2-[[1-[1-[(2-hydroxyphenyl)methoxy]-5-methyloctoxy]-5-methyloctoxy]methyl]phenol (PubChem CID 176548972) has the molecular formula C32H50O5 and a molecular weight of 514.75 g/mol. Its IUPAC name is 2-[[1-[1-[(2-hydroxyphenyl)methoxy]-5-methyloctoxy]-5-methyloctoxy]methyl]phenol.
| Compound Name | 2-[[1-[1-[(2-hydroxyphenyl)methoxy]-5-methyloctoxy]-5-methyloctoxy]methyl]phenol |
|---|---|
| PubChem CID | 176548972 |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | 2-[[1-[1-[(2-hydroxyphenyl)methoxy]-5-methyloctoxy]-5-methyloctoxy]methyl]phenol |
| SMILES | CCCC(C)CCCC(OCc1ccccc1O)OC(CCCC(C)CCC)OCc1ccccc1O |
| InChI | InChI=1S/C32H50O5/c1-5-13-25(3)15-11-21-31(35-23-27-17-7-9-19-29(27)33)37-32(22-12-16-26(4)14-6-2)36-24-28-18-8-10-20-30(28)34/h7-10,17-20,25-26,31-34H,5-6,11-16,21-24H2,1-4H3 |
| InChIKey | DQBMYEDTOUSTSU-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|