C28H36INO2 — CID 176549467
2-(4-iodoanilino)ethyl (1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 176549467) has the molecular formula C28H36INO2 and a molecular weight of 545.51 g/mol. Its IUPAC name is 2-(4-iodoanilino)ethyl (1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | 2-(4-iodoanilino)ethyl (1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 176549467 |
| Molecular Formula | C28H36INO2 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 2-(4-iodoanilino)ethyl (1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@](C)(C(=O)OCCNc3ccc(I)cc3)CCC[C@]21C |
| InChI | InChI=1S/C28H36INO2/c1-19(2)20-6-12-24-21(18-20)7-13-25-27(24,3)14-5-15-28(25,4)26(31)32-17-16-30-23-10-8-22(29)9-11-23/h6,8-12,18-19,25,30H,5,7,13-17H2,1-4H3/t25-,27-,28-/m1/s1 |
| InChIKey | ZUADEBQEFZBNNT-BIYCFNCWSA-N |
| XLogP | 7.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|