C43H60O5 — CID 118026456
2-[2-(1-methyl-7-propan-2-yl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl)oxyethoxy]ethyl 1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 118026456) has the molecular formula C43H60O5 and a molecular weight of 656.95 g/mol. Its IUPAC name is 2-[2-(1-methyl-7-propan-2-yl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl)oxyethoxy]ethyl 1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | 2-[2-(1-methyl-7-propan-2-yl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl)oxyethoxy]ethyl 1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 118026456 |
| Molecular Formula | C43H60O5 |
| Molecular Weight | 656.95 g/mol |
| Exact Mass | 656.44 |
| IUPAC Name | 2-[2-(1-methyl-7-propan-2-yl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl)oxyethoxy]ethyl 1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | CC(C)c1ccc2c(c1)CCC1C2CCCC1(C)C(=O)OCCOCCOC(=O)C1(C)CCCC2(C)c3ccc(C(C)C)cc3CCC12 |
| InChI | InChI=1S/C43H60O5/c1-28(2)30-11-15-34-32(26-30)13-17-37-35(34)10-8-19-42(37,6)39(44)47-24-22-46-23-25-48-40(45)43(7)21-9-20-41(5)36-16-12-31(29(3)4)27-33(36)14-18-38(41)43/h11-12,15-16,26-29,35,37-38H,8-10,13-14,17-25H2,1-7H3 |
| InChIKey | CJJQWRAHKHZCTP-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.95 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|