C29H37NO4 — CID 155541308
methyl (2S)-2-[[(1R,4aS,10aR)-1-methyl-7-propan-2-yl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl]amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 155541308) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is methyl (2S)-2-[[(1R,4aS,10aR)-1-methyl-7-propan-2-yl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl]amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[[(1R,4aS,10aR)-1-methyl-7-propan-2-yl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl]amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 155541308 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | methyl (2S)-2-[[(1R,4aS,10aR)-1-methyl-7-propan-2-yl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl]amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@]1(C)CCC[C@@H]2c3ccc(C(C)C)cc3CC[C@H]21 |
| InChI | InChI=1S/C29H37NO4/c1-18(2)20-9-13-23-21(17-20)10-14-25-24(23)6-5-15-29(25,3)28(33)30-26(27(32)34-4)16-19-7-11-22(31)12-8-19/h7-9,11-13,17-18,24-26,31H,5-6,10,14-16H2,1-4H3,(H,30,33)/t24-,25-,26+,29-/m1/s1 |
| InChIKey | ROFWWQVDHFTGFF-NANFOGFDSA-N |
| XLogP | 5.25 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |