C25H29ClN5O6PS — CID 176554826
2-(4-chlorophenyl)-3-(2-hydroxyethyl)-6-phenyl-5H-imidazo[1,2-a]purin-9-one;2-hydroxyethoxy(methoxy)phosphinothious acid;methanol (PubChem CID 176554826) has the molecular formula C25H29ClN5O6PS and a molecular weight of 594.03 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(2-hydroxyethyl)-6-phenyl-5H-imidazo[1,2-a]purin-9-one;2-hydroxyethoxy(methoxy)phosphinothious acid;methanol.
| Compound Name | 2-(4-chlorophenyl)-3-(2-hydroxyethyl)-6-phenyl-5H-imidazo[1,2-a]purin-9-one;2-hydroxyethoxy(methoxy)phosphinothious acid;methanol |
|---|---|
| PubChem CID | 176554826 |
| Molecular Formula | C25H29ClN5O6PS |
| Molecular Weight | 594.03 g/mol |
| Exact Mass | 593.13 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(2-hydroxyethyl)-6-phenyl-5H-imidazo[1,2-a]purin-9-one;2-hydroxyethoxy(methoxy)phosphinothious acid;methanol |
| SMILES | CO.COP(S)OCCO.O=c1c2nc(-c3ccc(Cl)cc3)n(CCO)c2nc2[nH]c(-c3ccccc3)cn12 |
| InChI | InChI=1S/C21H16ClN5O2.C3H9O3PS.CH4O/c22-15-8-6-14(7-9-15)18-24-17-19(26(18)10-11-28)25-21-23-16(12-27(21)20(17)29)13-4-2-1-3-5-13;1-5-7(8)6-3-2-4;1-2/h1-9,12,28H,10-11H2,(H,23,25);4,8H,2-3H2,1H3;2H,1H3 |
| InChIKey | HULRAJLUFXMAKB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 147.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.03 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|