C24H30BN3O2S — CID 176557254
CID 176557254 (PubChem CID 176557254) has the molecular formula C24H30BN3O2S and a molecular weight of 435.40 g/mol.
| Compound Name | CID 176557254 |
|---|---|
| PubChem CID | 176557254 |
| Molecular Formula | C24H30BN3O2S |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | — |
| SMILES | [B]C1(CC)CCC12CN(/C(=N/NS(=O)(=O)c1ccc(C)cc1)c1c(C)cccc1C)C2 |
| InChI | InChI=1S/C24H30BN3O2S/c1-5-24(25)14-13-23(24)15-28(16-23)22(21-18(3)7-6-8-19(21)4)26-27-31(29,30)20-11-9-17(2)10-12-20/h6-12,27H,5,13-16H2,1-4H3/b26-22+ |
| InChIKey | XROSZOHCNUHEHJ-XTCLZLMSSA-N |
| XLogP | 4.08 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|