About 7-methylidenebicyclo[3.2.1]octane-3,6-dione
7-methylidenebicyclo[3.2.1]octane-3,6-dione (PubChem CID 176564530) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 7-methylidenebicyclo[3.2.1]octane-3,6-dione.
Molecular Properties
| Compound Name | 7-methylidenebicyclo[3.2.1]octane-3,6-dione |
| PubChem CID | 176564530 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 7-methylidenebicyclo[3.2.1]octane-3,6-dione |
| SMILES | C=C1C(=O)C2CC(=O)CC1C2 |
| InChI | InChI=1S/C9H10O2/c1-5-6-2-7(9(5)11)4-8(10)3-6/h6-7H,1-4H2 |
| InChIKey | JANGBSBSZWUGAZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-methylidenebicyclo[3.2.1]octane-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylidenebicyclo[3.2.1]octane-3,6-dione?
The IUPAC name of 7-methylidenebicyclo[3.2.1]octane-3,6-dione (CID 176564530) is 7-methylidenebicyclo[3.2.1]octane-3,6-dione.
What is the SMILES notation for 7-methylidenebicyclo[3.2.1]octane-3,6-dione?
The canonical SMILES for 7-methylidenebicyclo[3.2.1]octane-3,6-dione is C=C1C(=O)C2CC(=O)CC1C2.
What is the InChIKey of 7-methylidenebicyclo[3.2.1]octane-3,6-dione?
The InChIKey is JANGBSBSZWUGAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-5-6-2-7(9(5)11)4-8(10)3-6/h6-7H,1-4H2.
What are the key properties of 7-methylidenebicyclo[3.2.1]octane-3,6-dione?
7-methylidenebicyclo[3.2.1]octane-3,6-dione has a molecular weight of 150.18 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylidenebicyclo[3.2.1]octane-3,6-dione is sourced from PubChem (CID 176564530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).