C13H24F2N2O — CID 176568021
1-[[2,2-difluoro-1-(propoxymethyl)cyclopropyl]methyl]-4-methylpiperazine (PubChem CID 176568021) has the molecular formula C13H24F2N2O and a molecular weight of 262.34 g/mol. Its IUPAC name is 1-[[2,2-difluoro-1-(propoxymethyl)cyclopropyl]methyl]-4-methylpiperazine.
| Compound Name | 1-[[2,2-difluoro-1-(propoxymethyl)cyclopropyl]methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 176568021 |
| Molecular Formula | C13H24F2N2O |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1-[[2,2-difluoro-1-(propoxymethyl)cyclopropyl]methyl]-4-methylpiperazine |
| SMILES | CCCOCC1(CN2CCN(C)CC2)CC1(F)F |
| InChI | InChI=1S/C13H24F2N2O/c1-3-8-18-11-12(9-13(12,14)15)10-17-6-4-16(2)5-7-17/h3-11H2,1-2H3 |
| InChIKey | DYCSNCCGTGFYAY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|