C15H22F12N2O — CID 145366151
1-[1,2-difluoro-2-(fluoromethyl)-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-4-(trifluoromethyl)piperazine;ethane (PubChem CID 145366151) has the molecular formula C15H22F12N2O and a molecular weight of 474.33 g/mol. Its IUPAC name is 1-[1,2-difluoro-2-(fluoromethyl)-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-4-(trifluoromethyl)piperazine;ethane.
| Compound Name | 1-[1,2-difluoro-2-(fluoromethyl)-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-4-(trifluoromethyl)piperazine;ethane |
|---|---|
| PubChem CID | 145366151 |
| Molecular Formula | C15H22F12N2O |
| Molecular Weight | 474.33 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 1-[1,2-difluoro-2-(fluoromethyl)-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-4-(trifluoromethyl)piperazine;ethane |
| SMILES | CC.FCC(F)(COCC(F)(F)C(F)C(F)(F)F)C(F)N1CCN(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H16F12N2O.C2H6/c14-5-10(17,6-28-7-11(18,19)8(15)12(20,21)22)9(16)26-1-3-27(4-2-26)13(23,24)25;1-2/h8-9H,1-7H2;1-2H3 |
| InChIKey | CKOHPCFTMSRQNZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|