C27H14N3O3S- — CID 176583575
2,4,6-tris(4-cyanophenyl)benzenesulfonate (PubChem CID 176583575) has the molecular formula C27H14N3O3S- and a molecular weight of 460.49 g/mol. Its IUPAC name is 2,4,6-tris(4-cyanophenyl)benzenesulfonate.
| Compound Name | 2,4,6-tris(4-cyanophenyl)benzenesulfonate |
|---|---|
| PubChem CID | 176583575 |
| Molecular Formula | C27H14N3O3S- |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 2,4,6-tris(4-cyanophenyl)benzenesulfonate |
| SMILES | N#Cc1ccc(-c2cc(-c3ccc(C#N)cc3)c(S(=O)(=O)[O-])c(-c3ccc(C#N)cc3)c2)cc1 |
| InChI | InChI=1S/C27H15N3O3S/c28-15-18-1-7-21(8-2-18)24-13-25(22-9-3-19(16-29)4-10-22)27(34(31,32)33)26(14-24)23-11-5-20(17-30)6-12-23/h1-14H,(H,31,32,33)/p-1 |
| InChIKey | WOYGOUNAPABLHD-UHFFFAOYSA-M |
| XLogP | 5.21 |
| TPSA | 128.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|