C33H68O3Si — CID 176590028
[7-[7-(3,7-dimethyloct-6-enoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctoxy]-trimethylsilane (PubChem CID 176590028) has the molecular formula C33H68O3Si and a molecular weight of 540.99 g/mol. Its IUPAC name is [7-[7-(3,7-dimethyloct-6-enoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctoxy]-trimethylsilane.
| Compound Name | [7-[7-(3,7-dimethyloct-6-enoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctoxy]-trimethylsilane |
|---|---|
| PubChem CID | 176590028 |
| Molecular Formula | C33H68O3Si |
| Molecular Weight | 540.99 g/mol |
| Exact Mass | 540.49 |
| IUPAC Name | [7-[7-(3,7-dimethyloct-6-enoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctoxy]-trimethylsilane |
| SMILES | CC(C)=CCCC(C)CCOC(C)(C)CCCC(C)CCOC(C)(C)CCCC(C)CCO[Si](C)(C)C |
| InChI | InChI=1S/C33H68O3Si/c1-28(2)16-13-17-29(3)20-25-34-32(6,7)23-14-18-30(4)21-26-35-33(8,9)24-15-19-31(5)22-27-36-37(10,11)12/h16,29-31H,13-15,17-27H2,1-12H3 |
| InChIKey | VVDUURNRXSVMEW-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.99 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|