C41H82O — CID 5326528
(E,6R)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriacont-14-ene (PubChem CID 5326528) has the molecular formula C41H82O and a molecular weight of 591.11 g/mol. Its IUPAC name is (E,6R)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriacont-14-ene.
| Compound Name | (E,6R)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriacont-14-ene |
|---|---|
| PubChem CID | 5326528 |
| Molecular Formula | C41H82O |
| Molecular Weight | 591.11 g/mol |
| Exact Mass | 590.64 |
| IUPAC Name | (E,6R)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriacont-14-ene |
| SMILES | COC(C)(C)CCCC(C)CCCC(C)CCCC(C)CCC/C=C(\C)CCCC(C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C41H82O/c1-34(2)20-14-23-37(5)26-17-29-38(6)27-15-24-35(3)21-12-13-22-36(4)25-16-28-39(7)30-18-31-40(8)32-19-33-41(9,10)42-11/h21,34,36-40H,12-20,22-33H2,1-11H3/b35-21+/t36?,37-,38?,39?,40?/m1/s1 |
| InChIKey | BDBFPWXSXZIJPV-XVMAKJPUSA-N |
| XLogP | 14.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.11 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|