C41H72O — CID 5326733
(6Z,10E,14E,19Z,23E)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,14,19,23-hexaene (PubChem CID 5326733) has the molecular formula C41H72O and a molecular weight of 581.03 g/mol. Its IUPAC name is (6Z,10E,14E,19Z,23E)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,14,19,23-hexaene.
| Compound Name | (6Z,10E,14E,19Z,23E)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,14,19,23-hexaene |
|---|---|
| PubChem CID | 5326733 |
| Molecular Formula | C41H72O |
| Molecular Weight | 581.03 g/mol |
| Exact Mass | 580.56 |
| IUPAC Name | (6Z,10E,14E,19Z,23E)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,14,19,23-hexaene |
| SMILES | COC(C)(C)CCCC(C)CC/C=C(\C)CC/C=C(/C)CCC/C=C(\C)CC/C=C(\C)CC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C41H72O/c1-34(2)20-14-23-37(5)26-17-29-38(6)27-15-24-35(3)21-12-13-22-36(4)25-16-28-39(7)30-18-31-40(8)32-19-33-41(9,10)42-11/h20-21,25-27,30,40H,12-19,22-24,28-29,31-33H2,1-11H3/b35-21+,36-25-,37-26-,38-27+,39-30+ |
| InChIKey | YZZHNFQAQCDIFI-RIWSVLGLSA-N |
| XLogP | 13.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.03 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|