C22H15F19O6 — CID 176591321
1,3,3,4,4,5,5-heptafluoro-2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxyethoxy]ethoxy]cyclopenten-1-yl]oxyethoxymethoxy]cyclopentene (PubChem CID 176591321) has the molecular formula C22H15F19O6 and a molecular weight of 736.32 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxyethoxy]ethoxy]cyclopenten-1-yl]oxyethoxymethoxy]cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxyethoxy]ethoxy]cyclopenten-1-yl]oxyethoxymethoxy]cyclopentene |
|---|---|
| PubChem CID | 176591321 |
| Molecular Formula | C22H15F19O6 |
| Molecular Weight | 736.32 g/mol |
| Exact Mass | 736.06 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxyethoxy]ethoxy]cyclopenten-1-yl]oxyethoxymethoxy]cyclopentene |
| SMILES | FC1=C(OCCOCCOC2=C(OCCOCOC3=C(F)C(F)(F)C(F)(F)C3(F)F)C(F)(F)C(F)(F)C2(F)F)C(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C22H15F19O6/c23-9-8(10(24)16(28,29)15(9,26)27)44-4-1-42-2-5-45-13-14(20(36,37)22(40,41)19(13,34)35)46-6-3-43-7-47-12-11(25)17(30,31)21(38,39)18(12,32)33/h9H,1-7H2 |
| InChIKey | NLBLOFAHTWFTPS-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.32 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|