C19H9F19O4 — CID 176591347
1,3,3,4,4,5,5-heptafluoro-2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxyethoxy]cyclopenten-1-yl]oxyethoxy]cyclopentene (PubChem CID 176591347) has the molecular formula C19H9F19O4 and a molecular weight of 662.24 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxyethoxy]cyclopenten-1-yl]oxyethoxy]cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxyethoxy]cyclopenten-1-yl]oxyethoxy]cyclopentene |
|---|---|
| PubChem CID | 176591347 |
| Molecular Formula | C19H9F19O4 |
| Molecular Weight | 662.24 g/mol |
| Exact Mass | 662.02 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxyethoxy]cyclopenten-1-yl]oxyethoxy]cyclopentene |
| SMILES | FC1=C(OCCOC2=C(OCCOC3=C(F)C(F)(F)C(F)(F)C3(F)F)C(F)(F)C(F)(F)C2(F)F)C(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C19H9F19O4/c20-6-5(7(21)13(25,26)12(6,23)24)39-1-2-41-10-11(17(33,34)19(37,38)16(10,31)32)42-4-3-40-9-8(22)14(27,28)18(35,36)15(9,29)30/h6H,1-4H2 |
| InChIKey | ZHTLNJBZKZHTQO-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.24 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|