C9H10F6O4 — CID 176591330
2-[3,3,4,4,5,5-hexafluoro-2-(2-hydroxyethoxy)cyclopenten-1-yl]oxyethanol (PubChem CID 176591330) has the molecular formula C9H10F6O4 and a molecular weight of 296.16 g/mol. Its IUPAC name is 2-[3,3,4,4,5,5-hexafluoro-2-(2-hydroxyethoxy)cyclopenten-1-yl]oxyethanol.
| Compound Name | 2-[3,3,4,4,5,5-hexafluoro-2-(2-hydroxyethoxy)cyclopenten-1-yl]oxyethanol |
|---|---|
| PubChem CID | 176591330 |
| Molecular Formula | C9H10F6O4 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-[3,3,4,4,5,5-hexafluoro-2-(2-hydroxyethoxy)cyclopenten-1-yl]oxyethanol |
| SMILES | OCCOC1=C(OCCO)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H10F6O4/c10-7(11)5(18-3-1-16)6(19-4-2-17)8(12,13)9(7,14)15/h16-17H,1-4H2 |
| InChIKey | NPYXTKOYLZDHDB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|