C18H16F12O6 — CID 163615326
10,10,11,11,12,12,22,22,23,23,24,24-dodecafluoro-2,5,8,14,17,20-hexaoxatricyclo[19.3.0.09,13]tetracosa-1(21),9(13)-diene (PubChem CID 163615326) has the molecular formula C18H16F12O6 and a molecular weight of 556.30 g/mol. Its IUPAC name is 10,10,11,11,12,12,22,22,23,23,24,24-dodecafluoro-2,5,8,14,17,20-hexaoxatricyclo[19.3.0.09,13]tetracosa-1(21),9(13)-diene.
| Compound Name | 10,10,11,11,12,12,22,22,23,23,24,24-dodecafluoro-2,5,8,14,17,20-hexaoxatricyclo[19.3.0.09,13]tetracosa-1(21),9(13)-diene |
|---|---|
| PubChem CID | 163615326 |
| Molecular Formula | C18H16F12O6 |
| Molecular Weight | 556.30 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | 10,10,11,11,12,12,22,22,23,23,24,24-dodecafluoro-2,5,8,14,17,20-hexaoxatricyclo[19.3.0.09,13]tetracosa-1(21),9(13)-diene |
| SMILES | FC1(F)C2=C(OCCOCCOC3=C(OCCOCCO2)C(F)(F)C(F)(F)C3(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C18H16F12O6/c19-13(20)9-10(14(21,22)17(13,27)28)35-7-3-32-4-8-36-12-11(34-6-2-31-1-5-33-9)15(23,24)18(29,30)16(12,25)26/h1-8H2 |
| InChIKey | HJLSMSKAEMETCG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|