C27H25F19O8 — CID 176591314
1,3,3,4,4,5,5-heptafluoro-2-[2-[2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-[2-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxyethoxy]ethoxy]ethoxy]cyclopenten-1-yl]oxyethoxy]ethoxy]ethoxy]cyclopentene (PubChem CID 176591314) has the molecular formula C27H25F19O8 and a molecular weight of 838.45 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-[2-[2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-[2-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxyethoxy]ethoxy]ethoxy]cyclopenten-1-yl]oxyethoxy]ethoxy]ethoxy]cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-[2-[2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-[2-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxyethoxy]ethoxy]ethoxy]cyclopenten-1-yl]oxyethoxy]ethoxy]ethoxy]cyclopentene |
|---|---|
| PubChem CID | 176591314 |
| Molecular Formula | C27H25F19O8 |
| Molecular Weight | 838.45 g/mol |
| Exact Mass | 838.12 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-[2-[2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-[2-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxyethoxy]ethoxy]ethoxy]cyclopenten-1-yl]oxyethoxy]ethoxy]ethoxy]cyclopentene |
| SMILES | FC1=C(OCCOCCOCCOC2=C(OCCOCCOCCOC3=C(F)C(F)(F)C(F)(F)C3(F)F)C(F)(F)C(F)(F)C2(F)F)C(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C27H25F19O8/c28-14-13(15(29)21(33,34)20(14,31)32)51-9-5-47-1-2-49-7-11-53-18-19(25(41,42)27(45,46)24(18,39)40)54-12-8-50-4-3-48-6-10-52-17-16(30)22(35,36)26(43,44)23(17,37)38/h14H,1-12H2 |
| InChIKey | BQUCVOAYDSSEAG-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.45 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|