C14H10F12O4 — CID 176591311
3,3,4,4,5,5-hexafluoro-1-[2-(3,3,4,4,5,5-hexafluoro-2-methoxycyclopenten-1-yl)oxyethoxy]-2-methoxycyclopentene (PubChem CID 176591311) has the molecular formula C14H10F12O4 and a molecular weight of 470.21 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-[2-(3,3,4,4,5,5-hexafluoro-2-methoxycyclopenten-1-yl)oxyethoxy]-2-methoxycyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-[2-(3,3,4,4,5,5-hexafluoro-2-methoxycyclopenten-1-yl)oxyethoxy]-2-methoxycyclopentene |
|---|---|
| PubChem CID | 176591311 |
| Molecular Formula | C14H10F12O4 |
| Molecular Weight | 470.21 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-[2-(3,3,4,4,5,5-hexafluoro-2-methoxycyclopenten-1-yl)oxyethoxy]-2-methoxycyclopentene |
| SMILES | COC1=C(OCCOC2=C(OC)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H10F12O4/c1-27-5-7(11(19,20)13(23,24)9(5,15)16)29-3-4-30-8-6(28-2)10(17,18)14(25,26)12(8,21)22/h3-4H2,1-2H3 |
| InChIKey | JQUUKXSFCQMLGO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.21 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|