C23H17F19O4 — CID 176591327
1,3,3,4,4,5,5-heptafluoro-2-[4-[3,3,4,4,5,5-hexafluoro-2-[4-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxybutoxy]cyclopenten-1-yl]oxybutoxy]cyclopentene (PubChem CID 176591327) has the molecular formula C23H17F19O4 and a molecular weight of 718.35 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-[4-[3,3,4,4,5,5-hexafluoro-2-[4-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxybutoxy]cyclopenten-1-yl]oxybutoxy]cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-[4-[3,3,4,4,5,5-hexafluoro-2-[4-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxybutoxy]cyclopenten-1-yl]oxybutoxy]cyclopentene |
|---|---|
| PubChem CID | 176591327 |
| Molecular Formula | C23H17F19O4 |
| Molecular Weight | 718.35 g/mol |
| Exact Mass | 718.08 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-[4-[3,3,4,4,5,5-hexafluoro-2-[4-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxybutoxy]cyclopenten-1-yl]oxybutoxy]cyclopentene |
| SMILES | FC1=C(OCCCCOC2=C(OCCCCOC3=C(F)C(F)(F)C(F)(F)C3(F)F)C(F)(F)C(F)(F)C2(F)F)C(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C23H17F19O4/c24-10-9(11(25)17(29,30)16(10,27)28)43-5-1-2-7-45-14-15(21(37,38)23(41,42)20(14,35)36)46-8-4-3-6-44-13-12(26)18(31,32)22(39,40)19(13,33)34/h10H,1-8H2 |
| InChIKey | VHBHPQHIDDKTRH-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.35 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|