C13H18F6O4 — CID 176591322
4-[3,3,4,4,5,5-hexafluoro-2-(4-hydroxybutoxy)cyclopenten-1-yl]oxybutan-1-ol (PubChem CID 176591322) has the molecular formula C13H18F6O4 and a molecular weight of 352.27 g/mol. Its IUPAC name is 4-[3,3,4,4,5,5-hexafluoro-2-(4-hydroxybutoxy)cyclopenten-1-yl]oxybutan-1-ol.
| Compound Name | 4-[3,3,4,4,5,5-hexafluoro-2-(4-hydroxybutoxy)cyclopenten-1-yl]oxybutan-1-ol |
|---|---|
| PubChem CID | 176591322 |
| Molecular Formula | C13H18F6O4 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 4-[3,3,4,4,5,5-hexafluoro-2-(4-hydroxybutoxy)cyclopenten-1-yl]oxybutan-1-ol |
| SMILES | OCCCCOC1=C(OCCCCO)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C13H18F6O4/c14-11(15)9(22-7-3-1-5-20)10(23-8-4-2-6-21)12(16,17)13(11,18)19/h20-21H,1-8H2 |
| InChIKey | LALVJTSOMCYYNF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|