C11H14F6O4 — CID 176591358
3-[3,3,4,4,5,5-hexafluoro-2-(3-hydroxypropoxy)cyclopenten-1-yl]oxypropan-1-ol (PubChem CID 176591358) has the molecular formula C11H14F6O4 and a molecular weight of 324.22 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-(3-hydroxypropoxy)cyclopenten-1-yl]oxypropan-1-ol.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-(3-hydroxypropoxy)cyclopenten-1-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 176591358 |
| Molecular Formula | C11H14F6O4 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-(3-hydroxypropoxy)cyclopenten-1-yl]oxypropan-1-ol |
| SMILES | OCCCOC1=C(OCCCO)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H14F6O4/c12-9(13)7(20-5-1-3-18)8(21-6-2-4-19)10(14,15)11(9,16)17/h18-19H,1-6H2 |
| InChIKey | LOOVYQUMYOBYLF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|