C21H13F19O4 — CID 176591315
1,3,3,4,4,5,5-heptafluoro-2-[3-[3,3,4,4,5,5-hexafluoro-2-[3-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxypropoxy]cyclopenten-1-yl]oxypropoxy]cyclopentene (PubChem CID 176591315) has the molecular formula C21H13F19O4 and a molecular weight of 690.29 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-[3-[3,3,4,4,5,5-hexafluoro-2-[3-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxypropoxy]cyclopenten-1-yl]oxypropoxy]cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-[3-[3,3,4,4,5,5-hexafluoro-2-[3-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxypropoxy]cyclopenten-1-yl]oxypropoxy]cyclopentene |
|---|---|
| PubChem CID | 176591315 |
| Molecular Formula | C21H13F19O4 |
| Molecular Weight | 690.29 g/mol |
| Exact Mass | 690.05 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-[3-[3,3,4,4,5,5-hexafluoro-2-[3-(2,3,3,4,4,5-hexafluorocyclopenten-1-yl)oxypropoxy]cyclopenten-1-yl]oxypropoxy]cyclopentene |
| SMILES | FC1=C(OCCCOC2=C(OCCCOC3=C(F)C(F)(F)C(F)(F)C3(F)F)C(F)(F)C(F)(F)C2(F)F)C(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C21H13F19O4/c22-8-7(9(23)15(27,28)14(8,25)26)41-3-1-5-43-12-13(19(35,36)21(39,40)18(12,33)34)44-6-2-4-42-11-10(24)16(29,30)20(37,38)17(11,31)32/h8H,1-6H2 |
| InChIKey | UKVTTZZWSQXWRA-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.29 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|