C24H30F12O6 — CID 176591337
1-butoxy-2-[2-[2-[2-(2-butoxy-3,3,4,4,5,5-hexafluorocyclopenten-1-yl)oxyethoxy]ethoxy]ethoxy]-3,3,4,4,5,5-hexafluorocyclopentene (PubChem CID 176591337) has the molecular formula C24H30F12O6 and a molecular weight of 642.47 g/mol. Its IUPAC name is 1-butoxy-2-[2-[2-[2-(2-butoxy-3,3,4,4,5,5-hexafluorocyclopenten-1-yl)oxyethoxy]ethoxy]ethoxy]-3,3,4,4,5,5-hexafluorocyclopentene.
| Compound Name | 1-butoxy-2-[2-[2-[2-(2-butoxy-3,3,4,4,5,5-hexafluorocyclopenten-1-yl)oxyethoxy]ethoxy]ethoxy]-3,3,4,4,5,5-hexafluorocyclopentene |
|---|---|
| PubChem CID | 176591337 |
| Molecular Formula | C24H30F12O6 |
| Molecular Weight | 642.47 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | 1-butoxy-2-[2-[2-[2-(2-butoxy-3,3,4,4,5,5-hexafluorocyclopenten-1-yl)oxyethoxy]ethoxy]ethoxy]-3,3,4,4,5,5-hexafluorocyclopentene |
| SMILES | CCCCOC1=C(OCCOCCOCCOC2=C(OCCCC)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C24H30F12O6/c1-3-5-7-39-15-17(21(29,30)23(33,34)19(15,25)26)41-13-11-37-9-10-38-12-14-42-18-16(40-8-6-4-2)20(27,28)24(35,36)22(18,31)32/h3-14H2,1-2H3 |
| InChIKey | WHJKZKNNXXYXIW-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.47 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|