C17H26F6O8 — CID 176591335
2-[2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]cyclopenten-1-yl]oxyethoxy]ethoxy]ethanol (PubChem CID 176591335) has the molecular formula C17H26F6O8 and a molecular weight of 472.38 g/mol. Its IUPAC name is 2-[2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]cyclopenten-1-yl]oxyethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]cyclopenten-1-yl]oxyethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 176591335 |
| Molecular Formula | C17H26F6O8 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 2-[2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]cyclopenten-1-yl]oxyethoxy]ethoxy]ethanol |
| SMILES | OCCOCCOCCOC1=C(OCCOCCOCCO)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C17H26F6O8/c18-15(19)13(30-11-9-28-7-5-26-3-1-24)14(16(20,21)17(15,22)23)31-12-10-29-8-6-27-4-2-25/h24-25H,1-12H2 |
| InChIKey | IJJBCDODCWNTIE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|