C17H26F6O4 — CID 176591342
6-[3,3,4,4,5,5-hexafluoro-2-(6-hydroxyhexoxy)cyclopenten-1-yl]oxyhexan-1-ol (PubChem CID 176591342) has the molecular formula C17H26F6O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is 6-[3,3,4,4,5,5-hexafluoro-2-(6-hydroxyhexoxy)cyclopenten-1-yl]oxyhexan-1-ol.
| Compound Name | 6-[3,3,4,4,5,5-hexafluoro-2-(6-hydroxyhexoxy)cyclopenten-1-yl]oxyhexan-1-ol |
|---|---|
| PubChem CID | 176591342 |
| Molecular Formula | C17H26F6O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 6-[3,3,4,4,5,5-hexafluoro-2-(6-hydroxyhexoxy)cyclopenten-1-yl]oxyhexan-1-ol |
| SMILES | OCCCCCCOC1=C(OCCCCCCO)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C17H26F6O4/c18-15(19)13(26-11-7-3-1-5-9-24)14(16(20,21)17(15,22)23)27-12-8-4-2-6-10-25/h24-25H,1-12H2 |
| InChIKey | UTJDWEFNTGZQTH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|