C14H20F6O5 — CID 176591328
5-[3,3,4,4,5,5-hexafluoro-2-[2-(2-hydroxyethoxy)ethoxy]cyclopenten-1-yl]oxypentan-1-ol (PubChem CID 176591328) has the molecular formula C14H20F6O5 and a molecular weight of 382.30 g/mol. Its IUPAC name is 5-[3,3,4,4,5,5-hexafluoro-2-[2-(2-hydroxyethoxy)ethoxy]cyclopenten-1-yl]oxypentan-1-ol.
| Compound Name | 5-[3,3,4,4,5,5-hexafluoro-2-[2-(2-hydroxyethoxy)ethoxy]cyclopenten-1-yl]oxypentan-1-ol |
|---|---|
| PubChem CID | 176591328 |
| Molecular Formula | C14H20F6O5 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 5-[3,3,4,4,5,5-hexafluoro-2-[2-(2-hydroxyethoxy)ethoxy]cyclopenten-1-yl]oxypentan-1-ol |
| SMILES | OCCCCCOC1=C(OCCOCCO)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H20F6O5/c15-12(16)10(24-6-3-1-2-4-21)11(13(17,18)14(12,19)20)25-9-8-23-7-5-22/h21-22H,1-9H2 |
| InChIKey | VLWWPYQNGDDGSQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|