C12H15N4Y- — CID 176600355
N-(1-methylpyrazol-3-yl)-5-propan-2-yl-4H-pyridin-4-id-2-amine;yttrium (PubChem CID 176600355) has the molecular formula C12H15N4Y- and a molecular weight of 304.19 g/mol. Its IUPAC name is N-(1-methylpyrazol-3-yl)-5-propan-2-yl-4H-pyridin-4-id-2-amine;yttrium.
| Compound Name | N-(1-methylpyrazol-3-yl)-5-propan-2-yl-4H-pyridin-4-id-2-amine;yttrium |
|---|---|
| PubChem CID | 176600355 |
| Molecular Formula | C12H15N4Y- |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-(1-methylpyrazol-3-yl)-5-propan-2-yl-4H-pyridin-4-id-2-amine;yttrium |
| SMILES | CC(C)c1[c-]cc(Nc2ccn(C)n2)nc1.[Y] |
| InChI | InChI=1S/C12H15N4.Y/c1-9(2)10-4-5-11(13-8-10)14-12-6-7-16(3)15-12;/h5-9H,1-3H3,(H,13,14,15);/q-1; |
| InChIKey | DFUGUMLRCFFVML-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|